|
| 3,3''-DibroMo-1,1':3',1''-terphenyl Basic information |
Product Name: | 3,3''-DibroMo-1,1':3',1''-terphenyl | Synonyms: | 3,3''-DibroMo-1,1':3',1''-terphenyl;1,3-Bis(3-bromophenyl)benzene;3,3''-dibromo-1,1':3',1''-Terpheny;1,1':3',1''-Terphenyl, 3,3''-dibromo-;3,3''-Dibromo-m-terphenyl;3,3''-Dibromo-1,1':3',1''-terphenyl b;3,3''-Dibromo-1,1':3',1''-terphenyl;3,3“-dibromo-1,1':3',1"-terphenyl | CAS: | 95962-62-2 | MF: | C18H12Br2 | MW: | 388.1 | EINECS: | | Product Categories: | | Mol File: | 95962-62-2.mol | ![3,3''-DibroMo-1,1':3',1''-terphenyl Structure](CAS/20150408/GIF/95962-62-2.gif) |
| 3,3''-DibroMo-1,1':3',1''-terphenyl Chemical Properties |
Melting point | 53.0 to 57.0 °C | Boiling point | 225°C/0.4mmHg(lit.) | density | 1.537±0.06 g/cm3(Predicted) | InChI | InChI=1S/C18H12Br2/c19-17-8-2-6-15(11-17)13-4-1-5-14(10-13)16-7-3-9-18(20)12-16/h1-12H | InChIKey | FGKHIPSLESGJNR-UHFFFAOYSA-N | SMILES | C1(C2=CC=CC(C3=CC=CC(Br)=C3)=C2)=CC=CC(Br)=C1 |
RIDADR | 3152 | HS Code | 2903.99.8001 | HazardClass | 9 | PackingGroup | II |
| 3,3''-DibroMo-1,1':3',1''-terphenyl Usage And Synthesis |
Chemical Properties | off-white powder |
| 3,3''-DibroMo-1,1':3',1''-terphenyl Preparation Products And Raw materials |
|