DBCO-PEG4-Acid manufacturers
- DBCO-PEG4-acid
-
- $0.00 / 50mg
-
2024-03-20
- CAS:1537170-85-6
- Min. Order: 50mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | DBCO-PEG4-Acid Basic information |
| Product Name: | DBCO-PEG4-Acid | | Synonyms: | DBCO-PEG4-Acid;Dibenzocyclooctyne-PEG4-acid;ADIBO-PEG4-acid 90% (HPLC);ADIBO-PEG4-acid;DBCO-PEG4-acid,DBCO-PEG4-COOH;DBCO-CONH-PEG4-acid;Aurumpharma u63872;4,7,10,13-Tetraoxa-16-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-17,20-dioxo- | | CAS: | 1537170-85-6 | | MF: | C30H36N2O8 | | MW: | 552.62 | | EINECS: | | | Product Categories: | ADC-Linkers | | Mol File: | 1537170-85-6.mol |  |
| | DBCO-PEG4-Acid Chemical Properties |
| Boiling point | 839.7±65.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | Solid or Viscous Liquid | | color | Yellow to Orange | | InChIKey | LKSAMQQFMTVPKD-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCNC(=O)CCC(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)=O |
| | DBCO-PEG4-Acid Usage And Synthesis |
| Description | DBCO-PEG4-acid is an analog of DBCO-Acid with PEG linker and a DBCO group. The DBCO groups is commonly used for copper-free Click Chemistry reactions due to its strain promoted high energy. The hydrophilic PEG chain allows for increased water solubility. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | Acid functionalized cyclooctyne derivative. Cyclooctynes are useful in strain-promoted copper-free azide-alkyne cycloaddition reactions. This dibenzocyclooctyne will react with azide functionalized compounds or biomolecules without the need for a Cu(I) catalyst to result in a stable triazole linkage. The PEG spacer adds hydrophilicity to the product to decrease aggregation. |
| | DBCO-PEG4-Acid Preparation Products And Raw materials |
|