| Company Name: |
Beijing Comparison Pharmaceutical Technology Co., Ltd
|
| Tel: |
010-010-52878169 15801002657 |
| Email: |
sales@bjcomparison.com |
| Products Intro: |
Product Name:4-amino-5-chloro-N-((4-(4-fluorobenzyl)morpholin-2-yl)methyl)-2-hydroxybenzamide
CAS:112914-16-6
Purity:≥98% Package:100mg
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Email: |
260366801@qq.com |
| Products Intro: |
Product Name:Mosapride Impurity 2
CAS:112914-16-6
Purity:98%以上 Package:10mg;50mg;100mg等多种规格 Remarks:REF-M23007
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:MosaprideImpurity2
CAS:112914-16-6
Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
- Mosapride Impurity 26
-
- $0.00 / 10mg
-
2024-08-22
- CAS:112914-16-6
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
|
| | Mosapride Impurity F Basic information |
| Product Name: | Mosapride Impurity F | | Synonyms: | Mosapride Impurity F;Benzamide, 4-amino-5-chloro-N-[[4-[(4-fluorophenyl)methyl]-2-morpholinyl]methyl]-2-hydroxy-;4-amino-5-chloro-N-((4-(4-fluorobenzyl)morpholin-2-yl)methyl)-2-hydroxybenzamide | | CAS: | 112914-16-6 | | MF: | C19H21ClFN3O3 | | MW: | 393.84 | | EINECS: | | | Product Categories: | | | Mol File: | 112914-16-6.mol |  |
| | Mosapride Impurity F Chemical Properties |
| Boiling point | 546.5±50.0 °C(Predicted) | | density | 1.360±0.06 g/cm3(Predicted) | | pka | 7.90±0.48(Predicted) | | InChI | InChI=1S/C19H21ClFN3O3/c20-16-7-15(18(25)8-17(16)22)19(26)23-9-14-11-24(5-6-27-14)10-12-1-3-13(21)4-2-12/h1-4,7-8,14,25H,5-6,9-11,22H2,(H,23,26) | | InChIKey | YUYBRAFXJUDSCE-UHFFFAOYSA-N | | SMILES | C(NCC1OCCN(CC2=CC=C(F)C=C2)C1)(=O)C1=CC(Cl)=C(N)C=C1O |
| | Mosapride Impurity F Usage And Synthesis |
| | Mosapride Impurity F Preparation Products And Raw materials |
|