4-Biphenylacetic acid NEW
| Price | $20 | $18 | $15 |
| Package | 1kg | 10kg | 100kg |
| Min. Order: | 1kg |
| Supply Ability: | 5000 Ton |
| Update Time: | 2024-05-29 |
Product Details
| Product Name: 4-Biphenylacetic acid | CAS No.: 5728-52-9 |
| EC-No.: 227-233-2 | Min. Order: 1kg |
| Purity: 99% | Supply Ability: 5000 Ton |
| Release date: 2024/05/29 |
| 4-Biphenylacetic acid Basic information |
| Product Name: | 4-Biphenylacetic acid |
| Synonyms: | 4-BIPHENYLACETICABID;Biphenyl-4-acetic acid 97%;4-Biphenylacetic acid/Felbinac;4 -BIPHENYLACETIC ACID 99% BP GRADE;4-BIPHENYL ACETIC ACID 98.5%;4-BIPHENYLACETIC ACID(METHOXYMETHYL)-1,1''-BIPHENYL;Napageln;4-Biphenylacetic acid ,99% |
| CAS: | 5728-52-9 |
| MF: | C14H12O2 |
| MW: | 212.24 |
| EINECS: | 227-233-2 |
| Product Categories: | Aromatics;Intermediates & Fine Chemicals;C13 to C42+;Carbonyl Compounds;Carboxylic Acids;Pharmaceuticals;Biphenyl derivatives;Biphenyl & Diphenyl ether;Organic acids;TRAXAM |
| Mol File: | 5728-52-9.mol |
 | |
| 4-Biphenylacetic acid Chemical Properties |
| Melting point | 159-160 °C (lit.) |
| Boiling point | 312.08°C (rough estimate) |
| density | 1.1035 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble50mg/mL, clear, colorless to yellow |
| form | Powder |
| pka | 4.29±0.10(Predicted) |
| color | Beige |
| Water Solubility | 39.27mg/L(25 ºC) |
| Merck | 14,3316 |
| BRN | 1211592 |
| InChI | InChI=1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
| InChIKey | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(CC(O)=O)C=C1 |
| CAS DataBase Reference | 5728-52-9(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | T,Xn |
| Risk Statements | 23/25-36/37/38-25-36/37/38/63-20/21/22 |
| Safety Statements | 26-36/37/39-45-37/39-28A-26/36/3745/60-20-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DU8229050 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29163900 |
| Toxicity | LD50 orally in rats: 164 mg/kg (Sloboda, Osterberg) |
Company Profile Introduction
Hebei duling International Trade Co., Ltd. is located in Shijiazhuang, the pharmaceutical capital of China. Our company operates in various forms, including production, sales and overseas trade. At the same time, we can provide biotechnology development, consultation, exchange and promotion, technical research of biomass energy, agricultural scientific research and experimental development, etc. Our core sector is the R & D, production and sales of chemical additives and chemical intermediates.
You may like
Recommended supplier
| Product name | Price | Suppliers | Update time | |
|---|---|---|---|---|
| $50.00/1KG |
VIP1Y
|
Zibo Hangyu Biotechnology Development Co., Ltd
|
2023-10-10 | |
| $0.00/25KG |
VIP5Y
|
Hebei Mojin Biotechnology Co., Ltd
|
2023-09-08 | |
| $100.00/1kg |
VIP5Y
|
Hebei Yanxi Chemical Co., Ltd.
|
2023-09-04 | |
| $15.00/1kg |
Hebei Linwo New Material Technology Co., LTD
|
2022-09-21 | ||
| $10.00/1kg |
Jiangsu Bangdeya New Material Technology Co.,Ltd
|
2022-04-23 | ||
| $0.00/1Kg/Bag |
VIP4Y
|
WUHAN FORTUNA CHEMICAL CO., LTD
|
2021-09-16 | |
| $15.00/1KG |
Zhuozhou Wenxi import and Export Co., Ltd
|
2021-07-10 | ||
| $3055.00/25Kg/Drum |
VIP4Y
|
Baoji Guokang Bio-Technology Co., Ltd.
|
2021-06-04 | |
| $1.00/1PCS |
VIP6Y
|
Hebei Guanlang Biotechnology Co., Ltd.
|
2021-04-23 | |
| $8.00/1kg |
VIP6Y
|
Career Henan Chemical Co
|
2018-12-21 |
China- Since: 2020-09-17
- Address: Room 902, Unit 2, Building 8, Haolin Garden,Shangcheng,No. 69 Shangcheng Road, Xinhua District, Shij
INQUIRY
+86-17333973358
sales06@hbduling.cn