|
| 4-Chloro-7-methoxyquinoline Basic information |
Product Name: | 4-Chloro-7-methoxyquinoline | Synonyms: | 4-CHLORO-7-METHOXYQUINOLINE;7-Methoxy-4-chloroquinoline;4-Chloro-7-methoxy-1-azanaphthalene;Quinoline, 4-chloro-7-methoxy-;4-Cholro-7-Methoxyquinoline;4-Chloro-7-methoxyquinoline, >=97%;4-Chloro-7-methoxyquinoline ISO 9001:2015 REACH | CAS: | 68500-37-8 | MF: | C10H8ClNO | MW: | 193.63 | EINECS: | 676-017-8 | Product Categories: | | Mol File: | 68500-37-8.mol | |
| 4-Chloro-7-methoxyquinoline Chemical Properties |
Melting point | 75-77 | Boiling point | 299.9±20.0 °C(Predicted) | density | 1.267±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | pka | 3.89±0.27(Predicted) | form | solid | color | Off-white to light yellow | InChI | InChI=1S/C10H8ClNO/c1-13-7-2-3-8-9(11)4-5-12-10(8)6-7/h2-6H,1H3 | InChIKey | UKTYNFPTZDSBLR-UHFFFAOYSA-N | SMILES | N1C2C(=CC=C(OC)C=2)C(Cl)=CC=1 | CAS DataBase Reference | 68500-37-8(CAS DataBase Reference) |
Hazard Codes | Xi,Xn | Risk Statements | 22-41 | Safety Statements | 26-39 | WGK Germany | 3 | Hazard Note | Irritant | HS Code | 2933491090 |
| 4-Chloro-7-methoxyquinoline Usage And Synthesis |
Chemical Properties | yellow powder |
| 4-Chloro-7-methoxyquinoline Preparation Products And Raw materials |
|