|
| 2-Fluoro-4-nitrobenzoic acid Basic information |
| 2-Fluoro-4-nitrobenzoic acid Chemical Properties |
Melting point | 170 °C | Boiling point | 352.5±27.0 °C(Predicted) | density | 1.568±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | form | powder to crystal | pka | 2.37±0.13(Predicted) | color | White to Light yellow | BRN | 2582091 | InChI | InChI=1S/C7H4FNO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11) | InChIKey | MMWFMFZFCKADEL-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1F | CAS DataBase Reference | 403-24-7(CAS DataBase Reference) |
Provider | Language |
ALFA
| English |
| 2-Fluoro-4-nitrobenzoic acid Usage And Synthesis |
Chemical Properties | white to light yellow crystal powder |
| 2-Fluoro-4-nitrobenzoic acid Preparation Products And Raw materials |
|