|
|
| | 4-(Trifluoromethoxy)nitrobenzene Basic information |
| Product Name: | 4-(Trifluoromethoxy)nitrobenzene | | Synonyms: | TIMTEC-BB SBB001666;P-NITRO (TRIFLUOROMETHOXY) BENZENE;4-(TRIFLUOROMETHOXY)NITROBENZENE;4-NITRO-1-TRIFLUOROMETHOXYBENZENE;4-nitrotrifluoromethoxybenzene;p-Nitro (Trifluoromethoxy) Benzene 4-(Trifluoromethoxy)nitrobenzene;4-(trifluoromrthoxy)nitrobebzene;4-(Trifluoromethoxy)nitrobenzene 98% | | CAS: | 713-65-5 | | MF: | C7H4F3NO3 | | MW: | 207.11 | | EINECS: | 671-689-9 | | Product Categories: | | | Mol File: | 713-65-5.mol |  |
| | 4-(Trifluoromethoxy)nitrobenzene Chemical Properties |
| Melting point | 15°C | | Boiling point | 87 °C | | density | 1,447 g/cm3 | | refractive index | 1.467 | | Fp | 87-89°C/15mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Soluble), Methanol (Sparingly) | | form | clear liquid | | color | Light orange to Yellow to Green | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 1966388 | | InChI | InChI=1S/C7H4F3NO3/c8-7(9,10)14-6-3-1-5(2-4-6)11(12)13/h1-4H | | InChIKey | UBEIKVUMDBCCRW-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(OC(F)(F)F)C=C1 | | CAS DataBase Reference | 713-65-5(CAS DataBase Reference) | | NIST Chemistry Reference | Alpha,alpha,alpha-trifluoro-4'-nitroanisole(713-65-5) |
| Provider | Language |
|
ALFA
| English |
| | 4-(Trifluoromethoxy)nitrobenzene Usage And Synthesis |
| Chemical Properties | Light yellow liquid | | Uses | 1-Nitro-4-(trifluoromethoxy)benzene can be used to manufacture tobacco flavor. | | Synthesis Reference(s) | Journal of the American Chemical Society, 109, p. 3708, 1987 DOI: 10.1021/ja00246a030 |
| | 4-(Trifluoromethoxy)nitrobenzene Preparation Products And Raw materials |
|