4-(4-BUTYLPHENYLAZO)PHENOL manufacturers
|
| 4-(4-BUTYLPHENYLAZO)PHENOL Basic information |
Product Name: | 4-(4-BUTYLPHENYLAZO)PHENOL | Synonyms: | 4-(4-BUTYLPHENYLAZO)PHENOL;4-BUTYL-4'-HYDROXYAZOBENZENE;4-(4-BUTYLPHENYLAZO)PHENOL EP;4-[(4-butylphenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one;4-(4-Butylphenylazo)phenol >Phenol, 4-[2-(4-butylphenyl)diazenyl]-;4-[2-(4-butylphenyl)diazenyl]-phenol;4-[(E)-(4-Butylphenyl)Diazenyl]Phenol | CAS: | 2496-21-1 | MF: | C16H18N2O | MW: | 254.33 | EINECS: | | Product Categories: | | Mol File: | 2496-21-1.mol | ![4-(4-BUTYLPHENYLAZO)PHENOL Structure](CAS/GIF/2496-21-1.gif) |
| 4-(4-BUTYLPHENYLAZO)PHENOL Chemical Properties |
Melting point | 80 °C | Boiling point | 424.5±38.0 °C(Predicted) | density | 1.06±0.1 g/cm3(Predicted) | solubility | soluble in Acetone | form | powder to crystal | pka | 8.92±0.15(Predicted) | color | Light yellow to Amber to Dark green | InChI | InChI=1S/C16H18N2O/c1-2-3-4-13-5-7-14(8-6-13)17-18-15-9-11-16(19)12-10-15/h5-12,19H,2-4H2,1H3 | InChIKey | FIWNTOUHYJJODB-UHFFFAOYSA-N | SMILES | C1(O)=CC=C(N=NC2=CC=C(CCCC)C=C2)C=C1 |
Risk Statements | 36/37/38 | Safety Statements | 26-36 | HS Code | 2927.00.5000 |
| 4-(4-BUTYLPHENYLAZO)PHENOL Usage And Synthesis |
| 4-(4-BUTYLPHENYLAZO)PHENOL Preparation Products And Raw materials |
|