|
| 1-Bromo-4-chloronaphthalene Basic information |
Product Name: | 1-Bromo-4-chloronaphthalene | Synonyms: | 1-Bromo-4-chloronaphthalene;1,4-BCN;Naphthalene, 1-bromo-4-chloro-;1-Bromo-4-chloronaphthalene ISO 9001:2015 REACH | CAS: | 53220-82-9 | MF: | C10H6BrCl | MW: | 241.51 | EINECS: | 201-615-9 | Product Categories: | | Mol File: | 53220-82-9.mol | |
| 1-Bromo-4-chloronaphthalene Chemical Properties |
Melting point | 66.5°C | Boiling point | 303°C (rough estimate) | density | 1.3874 (rough estimate) | refractive index | 1.5890 (estimate) | storage temp. | Under room temperature, keep away from direct sun light | form | Powder | color | White | InChI | InChI=1S/C10H6BrCl/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H | InChIKey | WUGJECZACFHDFE-UHFFFAOYSA-N | SMILES | C1(Br)=C2C(C=CC=C2)=C(Cl)C=C1 |
| 1-Bromo-4-chloronaphthalene Usage And Synthesis |
Uses | 1-Bromo-4-chloronaphthalene is an organic electroluminescent material that is a by-product of the OLED production process and can be used to make OLED displays, electronic components and electronic devices. |
| 1-Bromo-4-chloronaphthalene Preparation Products And Raw materials |
|