5-hexylbenzene-1,3-diol
|
|
5-hexylbenzene-1,3-diol 속성
- 끓는 점
- 192-195 °C
- 밀도
- 1.049±0.06 g/cm3(Predicted)
- 산도 계수 (pKa)
- 9.77±0.11(Predicted)
- InChI
- InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-11(13)9-12(14)8-10/h7-9,13-14H,2-6H2,1H3
- InChIKey
- XECRVULUEJSGBY-UHFFFAOYSA-N
- SMILES
- C1(O)=CC(CCCCCC)=CC(O)=C1
안전
5-hexylbenzene-1,3-diol C화학적 특성, 용도, 생산
용도
5-Hexyl Resorcinol is a resorcinol derivative isolated from Gmelina arborea. A potential antibacterial agentSynthesis Reference(s)
The Journal of Organic Chemistry, 37, p. 2901, 1972 DOI: 10.1021/jo00983a0255-hexylbenzene-1,3-diol 준비 용품 및 원자재
원자재
준비 용품
5-hexylbenzene-1,3-diol 공급 업체
글로벌( 43)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| PNP Biotech Co. Ltd | +8618516098983 |
sales@pnpbiotech.com | China | 1001 | 58 |
| Wuhan wingroup Pharmaceutical Co., Ltd | +86-13296627870; +8613296627870 |
info@whwingroup.com | China | 703 | 58 |
| Zhengzhou Anbu Chem Co.,Ltd | +86-0371-88006763; +8615988602810 |
sales@anbuchem.com | China | 3000 | 58 |
| Chongqing Zhihe Biopharmaceutical Co., Ltd. | +86-18580541567 +86-17782035140 |
sales@zhswyy.com | China | 326 | 58 |
| Firsky International Trade (Wuhan) Co., Ltd | +8615387054039 |
admin@firsky-cn.com | China | 436 | 58 |
| Henan Fengda Chemical Co., Ltd | +86-371-86557731 +86-13613820652 |
info@fdachem.com | China | 18223 | 58 |
| Xiamen Work-For-World Medicine Co.,Ltd. | +undefined15921822462 |
keqingyong@wfwmed.com | China | 203 | 58 |
| Henan Tianfu Chemical Co.,Ltd. | +86-0371-55170693 +86-19937530512 |
info@tianfuchem.com | China | 21689 | 55 |
| Shenzhen Nexconn Pharmatechs Ltd | +86-755-89396905 +86-15013857715 |
admin@nexconn.com | China | 10247 | 58 |
| Zhengzhou Alfa Chemical Co.,Ltd | +8618530059196 |
sale04@alfachem.cn | China | 12740 | 58 |