|
| 2-(2-AMINO-5-BROMOBENZOYL) PYRIDINE Basic information |
| 2-(2-AMINO-5-BROMOBENZOYL) PYRIDINE Chemical Properties |
Melting point | 98-100℃ | Boiling point | 451℃ | density | 1.546 | Fp | 227℃ | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | solubility | DMSO (Slightly), Methanol (Sparingly) | form | Solid | pka | 2.66±0.10(Predicted) | color | Light Yellow to Yellow | InChI | InChI=1S/C12H9BrN2O/c13-8-4-5-10(14)9(7-8)12(16)11-3-1-2-6-15-11/h1-7H,14H2 | InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N | SMILES | C(C1=CC(Br)=CC=C1N)(C1=NC=CC=C1)=O |
| 2-(2-AMINO-5-BROMOBENZOYL) PYRIDINE Usage And Synthesis |
Chemical Properties | Yellow Solid | Uses | Intermediate in the preparation of Bromazepam. |
| 2-(2-AMINO-5-BROMOBENZOYL) PYRIDINE Preparation Products And Raw materials |
|