| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:2,3-Dichloro-1-benzothiophene
CAS:5323-97-7
Purity:96% Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
0519-85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:2,3-dichloro-1-benzothiophene
CAS:5323-97-7
Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
|
| | 2,3-DICHLORO-BENZO[B]THIOPHENE Basic information |
| Product Name: | 2,3-DICHLORO-BENZO[B]THIOPHENE | | Synonyms: | 2,3-DICHLORO-BENZO[B]THIOPHENE;1,2-dichlorobenzo(b)thiophene;2,3-dichloro-thianaphthen;2,3-dichlorothianaphthene;2,3-dichlorothionaphthene;2,3-Dichloro-1-benzothiophene;Benzo[B]thiophene, 2,3-dichloro-;Inchi=1/C8H4cl2S/C9-7-5-3-1-2-4-6(5)11-8(7)10/H1-4 | | CAS: | 5323-97-7 | | MF: | C8H4Cl2S | | MW: | 203.09 | | EINECS: | | | Product Categories: | | | Mol File: | 5323-97-7.mol | ![2,3-DICHLORO-BENZO[B]THIOPHENE Structure](CAS/GIF/5323-97-7.gif) |
| | 2,3-DICHLORO-BENZO[B]THIOPHENE Chemical Properties |
| Melting point | 55-56 °C | | Boiling point | 300.2±22.0 °C(Predicted) | | density | 1.483±0.06 g/cm3(Predicted) |
| | 2,3-DICHLORO-BENZO[B]THIOPHENE Usage And Synthesis |
| | 2,3-DICHLORO-BENZO[B]THIOPHENE Preparation Products And Raw materials |
|