|
|
| | 7-Chlorobenzofuran Basic information |
| | 7-Chlorobenzofuran Chemical Properties |
| Boiling point | 214-216 °C | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | InChI | InChI=1S/C8H5ClO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H | | InChIKey | AROWSPBDKGWJNQ-UHFFFAOYSA-N | | SMILES | O1C2=C(Cl)C=CC=C2C=C1 |
| | 7-Chlorobenzofuran Usage And Synthesis |
| Uses | 7-Chlorobenzofuran is a useful organic compound that can be used to synthesize Benzofuran-7-ol[1]. | | References | [1] Cheung C, et al. Palladium-Catalyzed Hydroxylation of Aryl and Heteroaryl Halides Enabled by the Use of a Palladacycle Precatalyst. The Journal of Organic Chemistry, 2014; 79: 5351–5358. |
| | 7-Chlorobenzofuran Preparation Products And Raw materials |
|