- 5(6)-CFDA
-
- $1.00 / 1KG
-
2019-07-10
- CAS:124387-19-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | 5(6)-CFDA Basic information |
| Product Name: | 5(6)-CFDA | | Synonyms: | 5(6)-CARBOXYFLUORESCEIN DIACETATE;5(6)-CFDA;5(6)-CARBOXY-DI-O-ACETYLFLUORESCEIN;5(6)-FAM DIACETATE;5-(AND-6)-CARBOXYFLUORESCEIN DIACETATE;5(6)-FAM DA;Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-ar-carboxylicacid, 3',6'-bis(acetyloxy)-3-oxo-;5(6)-CFDA [5(6)-Carboxyfluorescein diacetate] | | CAS: | 124387-19-5 | | MF: | C50H32O18 | | MW: | 920.78 | | EINECS: | | | Product Categories: | | | Mol File: | 124387-19-5.mol |  |
| | 5(6)-CFDA Chemical Properties |
| storage temp. | Store at -20 | | solubility | DMSO: soluble | | form | A crystalline solid | | InChIKey | SWRGCNMDGRMQGB-UHFFFAOYSA-N | | SMILES | C12(OC(=O)C3=CC=CC(C(=O)O)=C13)C1C=CC(OC(C)=O)=CC=1OC1C=C(OC(=O)C)C=CC2=1.C12(OC(=O)C3=CC=C(C(=O)O)C=C13)C1C=CC(OC(=O)C)=CC=1OC1C=C(OC(=O)C)C=CC2=1 |
| WGK Germany | 3 | | HS Code | 2915390090 |
| | 5(6)-CFDA Usage And Synthesis |
| Uses | 5(6)-CFDA; 5(6)-Carboxyfluorescein Diacetate is a cell permeant, amine-reactive probe. | | Uses | 5(6)-CFDA is a popular, sensitive, fluorescent substrate for measuring esterase activity in live cells. It is often used in cell viability assays and "Live-Dead" assay systems, especially automated cell viability assays. |
| | 5(6)-CFDA Preparation Products And Raw materials |
|