N-(1-ADAMANTYL)ETHYLENEDIAMINE manufacturers
|
| | N-(1-ADAMANTYL)ETHYLENEDIAMINE Basic information |
| Product Name: | N-(1-ADAMANTYL)ETHYLENEDIAMINE | | Synonyms: | N-(1-ADAMANTYL)ETHYLENEDIAMINE;AKOS BC-0427;1-[N-(2-AMINOETHYL)AMINO]ADAMANTANE;CBI-BB ZERO/001765;1-adamantyl(2-aminoethyl)amine;N-(1-adamantyl)ethane-1,2-diamine;NSC 193472;N-Tricyclo[3.3.1.13,7]dec-1-yl-1,2-ethanediamine | | CAS: | 37818-93-2 | | MF: | C12H22N2 | | MW: | 194.32 | | EINECS: | 672-775-9 | | Product Categories: | Adamantanes | | Mol File: | 37818-93-2.mol |  |
| | N-(1-ADAMANTYL)ETHYLENEDIAMINE Chemical Properties |
| Boiling point | 295.5±8.0 °C(Predicted) | | density | 1,03 g/cm3 | | refractive index | 1.5220-1.5250 | | pka | 10.72±0.20(Predicted) | | form | clear liquid to cloudy liquid | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C12H22N2/c13-1-2-14-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,14H,1-8,13H2 | | InChIKey | IQMUFNISQFPZJC-UHFFFAOYSA-N | | SMILES | C(NC12CC3CC(CC(C3)C1)C2)CN |
| | N-(1-ADAMANTYL)ETHYLENEDIAMINE Usage And Synthesis |
| | N-(1-ADAMANTYL)ETHYLENEDIAMINE Preparation Products And Raw materials |
|