|
|
| | 1-Methoxy-5-methylphenazinium methyl sulfate Basic information |
| Product Name: | 1-Methoxy-5-methylphenazinium methyl sulfate | | Synonyms: | MOPMS;Methoxyphenazine-methosulfate;1-METHOXY-5-METHYLPHENAZINIUM METHYLSULFATE (1-METHOXY PMS);1-Methoxy-5-methyl-5-phenazinium·methylsulfate;1-Methoxy-5-MethylphenaziniuM Methyl Sulfate [for BiocheMical Research];Methoxyphenazine-Methosulfate research grade;1-Methoxy-5-Methylphenazin-5-iuM Methyl sulfate;Methoxy-PMS | | CAS: | 65162-13-2 | | MF: | C15H16N2O5S | | MW: | 336.36 | | EINECS: | 265-579-6 | | Product Categories: | | | Mol File: | 65162-13-2.mol |  |
| | 1-Methoxy-5-methylphenazinium methyl sulfate Chemical Properties |
| Melting point | 172 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Water: 1 mg/ml | | form | powder to crystal | | color | Orange to Brown to Dark purple | | InChI | InChI=1S/C14H13N2O.CH4O4S/c1-16-11-7-4-3-6-10(11)15-14-12(16)8-5-9-13(14)17-2;1-5-6(2,3)4/h3-9H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 | | InChIKey | MASUWVVNWALEEM-UHFFFAOYSA-M | | SMILES | S([O-])(=O)(=O)OC.O(C1=CC=CC2=[N+](C3=CC=CC=C3N=C12)C)C | | CAS DataBase Reference | 65162-13-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/38-40 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933.99.8290 |
| | 1-Methoxy-5-methylphenazinium methyl sulfate Usage And Synthesis |
| | 1-Methoxy-5-methylphenazinium methyl sulfate Preparation Products And Raw materials |
|