|
|
| | N-Succinimidyl 3-maleimidopropionate Basic information |
| | N-Succinimidyl 3-maleimidopropionate Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 448.8±47.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) | | pka | -2.39±0.20(Predicted) | | form | Solid | | color | White to Light Brown | | Water Solubility | Insoluble in water. | | Sensitive | Moisture Sensitive | | BRN | 1492578 | | InChI | InChI=1S/C11H10N2O6/c14-7-1-2-8(15)12(7)6-5-11(18)19-13-9(16)3-4-10(13)17/h1-2H,3-6H2 | | InChIKey | JKHVDAUOODACDU-UHFFFAOYSA-N | | SMILES | N1(CCC(ON2C(=O)CCC2=O)=O)C(=O)C=CC1=O | | CAS DataBase Reference | 55750-62-4(CAS DataBase Reference) |
| | N-Succinimidyl 3-maleimidopropionate Usage And Synthesis |
| Description | 3-Maleimido-propionic NHS ester contains a maleimide group and an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Chemical Properties | White to off-white solid | | Uses | 3-Maleimidopropionic acid N-hydroxysuccinimide ester is a reagent that is widely used for generating stable maleimide-activated carrier proteins that can spontaneously react with sulfhydryls. Alternatively these relatively stable maleimide-activated intermediates may be lyophilized and stored for later conjugation to a hapten. | | Uses | A short, sulfhydryl and amino reactive heterobifunctional crosslinking reagent, N-Succinimidyl 3-maleimidopropionate can also been used in immunodiagnostics. |
| | N-Succinimidyl 3-maleimidopropionate Preparation Products And Raw materials |
|