| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
010-82848833 400-666-7788 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:17β-Estradiol 3-β-D-Glucuronide
CAS:15270-30-1
Package:2.5Mg,25Mg
|
|
| | estradiol-3-glucuronide Basic information |
| Product Name: | estradiol-3-glucuronide | | Synonyms: | (17β)-17-Hydroxyestra-1,3,5(10)-trien-3-yl β-D-Glucopyranosiduronic Acid;3-(β-D-Glucopyranuronosyloxy) Estra-1,3,5(10)-trien-17β-ol;estradiol-3-glucuronide;17β-Estradiol 3-β-D-Glucuronide;17beta-estradiol 3-glucosiduronic acid;Estradiol Impurity 6;β-D-Glucopyranosiduronic acid, (17β)-17-hydroxyestra-1,3,5(10)-trien-3-yl;Estradiol 3-O-β-D-glucuronide | | CAS: | 15270-30-1 | | MF: | C24H32O8 | | MW: | 448.51 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Steroids;Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 15270-30-1.mol |  |
| | estradiol-3-glucuronide Chemical Properties |
| Melting point | 270-275°C | | Boiling point | 702.7±60.0 °C(Predicted) | | density | 1.423±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.80±0.70(Predicted) | | color | White to Off-White | | InChIKey | MUOHJTRCBBDUOW-GVRVQZKZNA-N | | SMILES | [C@@]12([H])CCC3C=C(O[C@H]4[C@H](O)[C@H]([C@H](O)[C@@H](C(=O)O)O4)O)C=CC=3[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])O |&1:0,8,9,11,12,14,23,27,29,32,r| |
| | estradiol-3-glucuronide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Estradiol (E888000). | | Definition | ChEBI: A steroid glucosiduronic acid that consists of 17beta-estradiol having a beta-glucuronyl residue attached at position 3 via a glycosidic linkage. |
| | estradiol-3-glucuronide Preparation Products And Raw materials |
|