|
|
| Product Name: | AT-56 | | Synonyms: | AT56/AT-56;4-(DIBENZO[1,2-A:1',2'-E][7]ANNULEN-11-YLIDENE)-1-[4-(2H-TETRAZOL-5-YL)BUTYL]PIPERIDINE;4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-[4-(1H-tetrazol-5-yl)butyl]piperidine;4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-[4-(2H-tetrazol-5-yl)butyl]-piperidine;AT 56;4-Dibenzo[a,d]cyclohepten-5-ylidene-1-[4-(2H-tetrazol-5-yl)-butyl]-piperidine;AT 56, >=98%;CS-1414 | | CAS: | 162640-98-4 | | MF: | C25H27N5 | | MW: | 397.52 | | EINECS: | 200-256-5 | | Product Categories: | Inhibitors | | Mol File: | 162640-98-4.mol |  |
| | AT-56 Chemical Properties |
| Boiling point | 620.4±65.0 °C(Predicted) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO: soluble10mg/mL, clear | | pka | 4.99±0.10(Predicted) | | form | powder | | color | white to beige | | InChIKey | LQNGMDUIRLSESZ-UHFFFAOYSA-N | | SMILES | N1(CCCCC2=NNN=N2)CC/C(=C2/C3=CC=CC=C3C=CC3=CC=CC=C3/2)/CC1 |
| | AT-56 Usage And Synthesis |
| Uses | AT-56 is an orally active inhibitor of Lipocalin-type prostaglandin D synthase. | | in vitro |
AT-56 (1-30 μM; 10 minutes) dose-dependently inhibits the production of PGD2 in L-PGDS-expressing human medulloblastoma TE-671 cells with an IC50 of about 3 μM.
| | in vivo | AT-56 (1-30 mg/kg; p.o.) suppresses the PGD2 production in the stab-wounded brain.
AT-56 (1-10 mg/kg; p.o.) suppresses the L-PGDS-mediated allergic airway inflammation in mice.
AT-56 (10 mg/kg; p.o.) exhibits Cmax (2.15 μg/ml), half-life (1.71 h) and high oral bioavailability (82%). | | storage | Store at -20°C |
| | AT-56 Preparation Products And Raw materials |
|