|
| 4-Ethyl-5-fluoropyrimidine Basic information |
| 4-Ethyl-5-fluoropyrimidine Chemical Properties |
Boiling point | 169.5±20.0 °C(Predicted) | density | 1.117±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform (Slightly), Methanol (Slightly) | form | Oil | pka | 0.95±0.16(Predicted) | color | Clear Colourless | Stability: | Volatile | InChI | InChI=1S/C6H7FN2/c1-2-6-5(7)3-8-4-9-6/h3-4H,2H2,1H3 | InChIKey | AYZDRTRWCASUFO-UHFFFAOYSA-N | SMILES | C1=NC=C(F)C(CC)=N1 | CAS DataBase Reference | 137234-88-9(CAS DataBase Reference) |
| 4-Ethyl-5-fluoropyrimidine Usage And Synthesis |
Uses | 4-Ethyl-5-fluoropyrimidine (Voriconazole EP Impurity C) is a Voriconazole (V760000) impurity. |
| 4-Ethyl-5-fluoropyrimidine Preparation Products And Raw materials |
|