|
|
| | 4-(Trifluoromethyl)benzophenone Basic information |
| Product Name: | 4-(Trifluoromethyl)benzophenone | | Synonyms: | 4-(TRIFLUOROMETHYL)BENZOPHENONE;4-(TRIFLUOROMETHYL)BENZOPHENONE 97%;4-(Trifluoromethyl)benzophenone97%;4-(Trifluoromethyl)benzophenone, 98+%;Phenyl[4-(trifluoromethyl)phenyl] ketone;Phenyl(4-(trifluoromethyl);Methanone, phenyl[4-(trifluoromethyl)phenyl]-;PHENYL[4-(TRIFLUOROMETHYL)PHENYL]METHANONE | | CAS: | 728-86-9 | | MF: | C14H9F3O | | MW: | 250.22 | | EINECS: | 211-974-3 | | Product Categories: | | | Mol File: | 728-86-9.mol |  |
| | 4-(Trifluoromethyl)benzophenone Chemical Properties |
| Melting point | 114-116 °C(lit.) | | Boiling point | 309.2±42.0 °C(Predicted) | | density | 1.2778 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Solid | | color | Off-white to beige | | BRN | 1879572 | | InChI | InChI=1S/C14H9F3O/c15-14(16,17)12-8-6-11(7-9-12)13(18)10-4-2-1-3-5-10/h1-9H | | InChIKey | OHTYZZYAMUVKQS-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(C1=CC=C(C(F)(F)F)C=C1)=O | | CAS DataBase Reference | 728-86-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29147000 |
| | 4-(Trifluoromethyl)benzophenone Usage And Synthesis |
| Chemical Properties | OFF-WHITE TO BEIGE CRYSTALLINE SOLID | | Synthesis |
A solution of diphenylmethanol (1 mmol), NBS (1.3equiv.), KOAc (1.5 equiv.) H2O (1.5 mL), and CH2Cl2 (0.5mL) was magnetically stirred in 25 mL flask at room temperaturefor 10 h. The reaction mixture was added into water(10 mL), and extracted with EtOAc (3 × 10 mL). The combinedEtOAc extracts were dried over anhydrous MgSO4,filtrated, and then the solvent was removed under reducedpressure. The residue was purified by the flash columnchromatography on silica gel with PE or PE/EtOAc as theeluent to obtain the desired product 4-(Trifluoromethyl)benzophenone.
|
| | 4-(Trifluoromethyl)benzophenone Preparation Products And Raw materials |
|