| Company Name: |
Shanghai Ennopharm Co., Ltd.
|
| Tel: |
+86 (21) 6435-5022 |
| Email: |
|
| Products Intro: |
Product Name:3-ethyl-3-(phenoxymethyl)oxetane
CAS:3897-65-2
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 18112977050 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:3-Ethyl-3-(phenoxymethyl)oxetane
CAS:3897-65-2
Purity:95+% Package:1g;5g;10g
|
|
| | 3-ethyl-3-(phenoxymethyl)-Oxetane Basic information |
| | 3-ethyl-3-(phenoxymethyl)-Oxetane Chemical Properties |
| Boiling point | 275℃ | | density | 1.025 | | Fp | 104℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | InChI | InChI=1S/C12H16O2/c1-2-12(8-13-9-12)10-14-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 | | InChIKey | JUXZNIDKDPLYBY-UHFFFAOYSA-N | | SMILES | O1CC(CC)(COC2=CC=CC=C2)C1 |
| | 3-ethyl-3-(phenoxymethyl)-Oxetane Usage And Synthesis |
| Chemical Properties | clear liquid |
| | 3-ethyl-3-(phenoxymethyl)-Oxetane Preparation Products And Raw materials |
|