|
|
| Melting point | 21.1°C | | Boiling point | 410.55°C (rough estimate) | | density | 1.027 g/mL at 25 °C (lit.) | | refractive index | 1.5486-1.5506 | | Fp | 113 °C | | storage temp. | Refrigerator | | solubility | soluble in Methanol | | form | powder to lump to clear liquid | | pka | 4.24±0.50(Predicted) | | color | White or Colorless to Light orange to Yellow | | InChI | InChI=1S/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3 | | InChIKey | FEIWNULTQYHCDN-UHFFFAOYSA-N | | SMILES | C1(N=CC2=CC=C(OC)C=C2)=CC=C(CCCC)C=C1 | | CAS DataBase Reference | 26227-73-6(CAS DataBase Reference) | | EPA Substance Registry System | N-(4-Methoxybenzylidine)-4'-butylaniline (26227-73-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | RTECS | BW9550000 | | HS Code | 2921.42.9000 |
| Provider | Language |
|
ACROS
| English |
| Chemical Properties | TURBID YELLOW LIQUID | | General Description | Cloudy light yellow liquid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | MBBA neutralizes acids in exothermic reactions to form salts plus water. May be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen may be generated in combination with strong reducing agents, such as hydrides. | | Fire Hazard | MBBA is combustible. |
| | MBBA Preparation Products And Raw materials |
|