Sertraline EP IMpurity B
- CAS No.
- 52758-05-1
- Chemical Name:
- Sertraline EP IMpurity B
- Synonyms
- Setraline impurity B;Sertraline EP IMpurity B;Sertraline EP Impurity B HCl;(1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4;Sertraline hydrochloride Impurity 1;Sertraline Impurity 2（Sertraline EP Impurity B）;Sertraline Hydrochloride EP Impurity B as Hydrochloride;cis-1,2,3,4-Tetrahydro-N-methyl-4-phenyl-1-naphthalenamine hydrochloride;Sertraline Impurity 2 Hydrochloride(Sertraline EP Impurity B Hydrochloride);(1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Hydrochloride
- CBNumber:
- CB12630479
- Molecular Formula:
- C17H20ClN
- Molecular Weight:
- 273.8
- MOL File:
- 52758-05-1.mol
- Modify Date:
- 2023/5/15 10:44:00
| solubility | DMSO (Slightly), Methanol (Slightly) |
|---|---|
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C17H19N.ClH/c1-18-17-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17;/h2-10,14,17-18H,11-12H2,1H3;1H/t14-,17-;/s3 |
| InChIKey | XTSOELQVDLSJFM-ZXIWTAKENA-N |
| SMILES | N([C@H]1CC[C@@H](C2C=CC=CC=2)C2=CC=CC=C12)C.Cl |&1:1,4,r| |
Sertraline EP IMpurity B Preparation Products And Raw materials
Raw materials
Preparation Products
Global( 54)Suppliers
| Supplier | Tel | Country | ProdList | Advantage | Inquiry |
|---|---|---|---|---|---|
| AnalyticsStanza Inc | +91-7032031309 +91-7032031309 | Hyderabad, India | 227 | 58 | Inquiry |
| GLP Pharma Standards | +91 9866074638 | Hyderabad, India | 1644 | 58 | Inquiry |
| CLEARSYNTH LABS LTD. | +91-22-45045900 | Hyderabad, India | 6351 | 58 | Inquiry |
| SynZeal Research Pvt Ltd | +1 226-802-2078 | Gujarat, India | 6522 | 58 | Inquiry |
| Pharmaffiliates Analytics and Synthetics P. Ltd | +91-172-5066494 | Haryana, India | 6773 | 58 | Inquiry |
| Shenzhen Excellent Biomedical Technology Co.,Ltd. | +86-0755-26050679 +86-15915472436 | China | 1031 | 58 | Inquiry |
| Shaanxi Dideu Medichem Co. Ltd | +86-29-87569266 15319487004 | China | 4088 | 58 | Inquiry |
| sgtlifesciences pvt ltd | +8617013299288 | China | 12382 | 58 | Inquiry |
| China National Standard Pharmaceutical Corporation Limited | +8615391658522 | China | 11927 | 58 | Inquiry |
| Hefei fuya biotechnology co. LTD | 18096409024 | China | 1977 | 58 | Inquiry |
52758-05-1(Sertraline EP IMpurity B)Related Search:
Rac-trans-Sertraline
trans-(±)-4-(3,4-Dichlorophenyl)-
1,2,3,4-tetrahydro-N,N-diMethyl-1-naphthalenaMine Hydrochloride
Sertraline
(1R,4R)-Sertraline 4-Chlorophenyl IMpurity HCl
(4R)-(3',4'-Dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one
chevron_left
1of3
chevron_right
Sertraline EP IMpurity B
cis-1,2,3,4-Tetrahydro-N-methyl-4-phenyl-1-naphthalenamine hydrochloride
Sertraline hydrochloride Impurity 1
Sertraline Impurity 2（Sertraline EP Impurity B）
(1S,4S)-N-Methyl-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine hy drochloride (1:1)
Sertraline EP Impurity B HCl
(1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4
Sertraline EP Impurity BQ: What is
Sertraline EP Impurity B Q: What is the CAS Number of
Sertraline EP Impurity B Q: What is the storage condition of
Sertraline EP Impurity B Q: What are the applications of
Sertraline EP Impurity B
(1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Hydrochloride
Sertraline Hydrochloride EP Impurity B as Hydrochloride
Sertraline Impurity 2 Hydrochloride(Sertraline EP Impurity B Hydrochloride)
rel-(1S,4S)-N-Methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride (Sertraline Impurity)
Setraline impurity B
52758-05-1