L-Phenylalanine, N-L-leucyl-, methyl ester
|
|
L-Phenylalanine, N-L-leucyl-, methyl ester 속성
- 끓는 점
- 457.4±40.0 °C(Predicted)
- 밀도
- 1.088±0.06 g/cm3(Predicted)
- 산도 계수 (pKa)
- 13.74±0.46(Predicted)
- InChI
- InChI=1S/C16H24N2O3/c1-11(2)9-13(17)15(19)18-14(16(20)21-3)10-12-7-5-4-6-8-12/h4-8,11,13-14H,9-10,17H2,1-3H3,(H,18,19)/t13-,14-/m0/s1
- InChIKey
- DJBPSNXKZLENEZ-KBPBESRZSA-N
- SMILES
- C(OC)(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(C)C)N
안전
L-Phenylalanine, N-L-leucyl-, methyl ester C화학적 특성, 용도, 생산
용도
L-Phenylalanine, N-L-leucyl-, methyl ester, commonly named Carfilzomib Impurity 3, is a valuable organic compound that could be used as an impurity reference of Carfilzomib which is used alone and in combination with other medications to treat people with multiple myeloma.L-Phenylalanine, N-L-leucyl-, methyl ester 준비 용품 및 원자재
원자재
준비 용품
L-Phenylalanine, N-L-leucyl-, methyl ester 공급 업체
글로벌( 9)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| ShenZhen H&D Pharmaceutical Technology Co., LTD | +86-0755-22677845 +86-13627253706 |
sale@hdimpurity.com | China | 3154 | 58 |
| Hangzhou MolCore BioPharmatech Co.,Ltd. | +86-057181025280; +8617767106207 |
sales@molcore.com | China | 49739 | 58 |
| Abydos Scientific | 025-84767922 18936879710 |
sales@abydoscientific.com | China | 994 | 58 |
| Jinan blalong chemical co. LTD | 2710913286@.com |
1513643261@qq.com | China | 14253 | 58 |
| SHENZHEN PHYSTANDARD BIO-TECH CO.,LTD | 0755-0755-0755-83725350 13380397412 |
3001280422@qq.com | China | 10077 | 58 |
| Henan Weitesi Chemical Technology Co. LTD | 0371-0371-55135753 18003832934 |
2853979818@qq.com | China | 9994 | 58 |
| Sichuan Lanli Pharmaceutical Co., Ltd. | 028-61186658 15881182642 |
2377807226@qq.com | China | 179 | 58 |
| Molcoo Chemicals Inc. | 18627753421 |
3001071511@qq.com | China | 9180 | 58 |
| Lianhe Aigen Pharmatech Co.,Ltd. | 18918657159 |
sales-Aigen@lianhetech.com | China | 2999 | 58 |