potassium(R) 3-hydroxybutyrate
|
|
potassium(R) 3-hydroxybutyrate 속성
- InChI
- InChI=1/C4H8O3.K/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1/t3-;/s3
- InChIKey
- CINYGFCEISABSR-OQFXAWDINA-M
- SMILES
- [K+].C([O-])(=O)C[C@H](O)C |&1:5,r|
안전
potassium(R) 3-hydroxybutyrate C화학적 특성, 용도, 생산
용도
(R)-3-Hydroxybutyrate, potassium salt is used as a food supplement in ketogenic diet.일반 설명
Poly-(R)-3-hydroxybutyrates (PHB) are linear polymers of (R)-3-hydroxybutyrate. They are components of all biological cells[1].potassium(R) 3-hydroxybutyrate 준비 용품 및 원자재
원자재
준비 용품
potassium(R) 3-hydroxybutyrate 공급 업체
글로벌( 39)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| GIHI CHEMICALS CO.,LIMITED | +8618058761490 |
info@gihichemicals.com | China | 49978 | 58 |
| Chongqing Chemdad Co., Ltd | +86-023-6139-8061 +86-86-13650506873 |
sales@chemdad.com | China | 39894 | 58 |
| career henan chemical co | +86-0371-86658258 +8613203830695 |
factory@coreychem.com | China | 29811 | 58 |
| CD Chemical Group Limited | +8615986615575 |
info@codchem.com | China | 20342 | 58 |
| Henan Aochuang Chemical Co.,Ltd. | +86-0371-63689365 +8618638391208 |
sales@aochuangchem.com | China | 9237 | 58 |
| Hebei Weibang Biotechnology Co., Ltd | +8617732866630 |
bess@weibangbio.com | China | 18153 | 58 |
| ChiRial Biomaterial Co Ltd | +8619951673840 |
cero.xia@chirial.com | China | 156 | 58 |
| Shaanxi LonierHerb Bio Technology Co Ltd | +86-86-+86-86-029-87551862 +8617702909819 |
sales006@ingredients-lonier.com | China | 2633 | 58 |
| Changzhou AniKare Pharmatech Co., Ltd. | +86-0519-8359-8696 +8618018249389 |
sales@anikare.com | China | 9302 | 58 |
| Guangzhou CATO Research Chemicals Inc. | +86-020-81960175-617 +8615602392859 |
Intermediate@cato-chem.com | China | 8056 | 58 |