5'-O-DMT-N2-이소부티릴-2'-O-메틸-D-구아노신
|
|
5'-O-DMT-N2-이소부티릴-2'-O-메틸-D-구아노신 속성
- 밀도
- 1.35±0.1 g/cm3(Predicted)
- 저장 조건
- 2-8°C
- 용해도
- 아세토니트릴에 용해됨
- 산도 계수 (pKa)
- 9.16±0.20(Predicted)
- 물리적 상태
- 가루
- 색상
- 흰색에서 연한 노란색
- InChIKey
- ISQLJOGRNUQHJX-WKLYCMIMNA-N
- SMILES
- O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(NC(=N3)NC(=O)C(C)C)=O)N=C2)[C@H](OC)[C@@H]1O |&1:25,27,44,47,r|
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| HS 번호 | 29389090 |
|---|
| 그림문자(GHS): |
|
||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Warning | ||||||||||||||||||||||||||||
| 유해·위험 문구: |
|
||||||||||||||||||||||||||||
| 예방조치문구: |
|
5'-O-DMT-N2-이소부티릴-2'-O-메틸-D-구아노신 C화학적 특성, 용도, 생산
화학적 성질
powder용도
5''-O-DMT-N2-Isobutyryl-2''-O-methyl-D-guanosine (CAS# 114745-26-5) is a guanosine derivative used in the preparation of synthetic RNA derivatives such as native-like crosslinked duplex RNA for use in biochemical and nanotechnology studies.생물학적 활성
5'-O-Dmt-n2-isobutyryl-2'-o-methyl-d-guanosine has been shown to have an affinity for tissues in a chemotactic assay.5'-O-DMT-N2-이소부티릴-2'-O-메틸-D-구아노신 준비 용품 및 원자재
원자재
준비 용품
5'-O-DMT-N2-이소부티릴-2'-O-메틸-D-구아노신 공급 업체
글로벌( 88)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Alchem Pharmtech,Inc. | 8485655694 |
sales@alchempharmtech.com | United States | 63711 | 58 |
| Antai Fine Chemical Technology Co.,Limited | 18503026267 |
info@antaichem.com | CHINA | 9641 | 58 |
| SHANGHAI T&W PHARMACEUTICAL CO., LTD. | +86-021-61551413 +8618813727289 |
contact@trustwe.com | China | 5738 | 58 |
| Zhengzhou Alfa Chemical Co.,Ltd | +8618530059196 |
sale04@alfachem.cn | China | 12898 | 58 |
| Career Henan Chemica Co | +86-0371-86658258 15093356674; |
laboratory@coreychem.com | China | 30255 | 58 |
| BOC Sciences | 16314854226; +16314854226 |
inquiry@bocsci.com | United States | 19743 | 58 |
| NewCan Biotech Limited | +86-0571-86912261 +8613735419629 |
sales@newcanbio.com | China | 9980 | 58 |
| Zhejiang Hengkang Pharmaceutical Co., Ltd. | +86-576-83372028 +86-18868723926 |
bd1@hengkangpharm.cn | China | 119 | 58 |
| Wuhu Nuowei chemistry Co., Ltd. | +86-0553-2911116-802 +undefined17756524438 |
sales1@nuowei-chem.com | China | 1640 | 58 |
| Henan Aochuang Chemical Co.,Ltd. | +86-0371-63689365 +8618638391208 |
sales@aochuangchem.com | China | 9425 | 58 |