4-Chloro-5-methoxypyrimidin-2-amine
|
|
4-Chloro-5-methoxypyrimidin-2-amine 속성
- 녹는점
- 146-148 °C(Solv: water, 20% (7732-18-5); acetic acid (64-19-7); ethanol (64-17-5))
- 끓는 점
- 345.3±45.0 °C(Predicted)
- 밀도
- 1.398±0.06 g/cm3(Predicted)
- 저장 조건
- 2-8°C(protect from light)
- 산도 계수 (pKa)
- 3.41±0.10(Predicted)
- InChI
- InChI=1S/C5H6ClN3O/c1-10-3-2-8-5(7)9-4(3)6/h2H,1H3,(H2,7,8,9)
- InChIKey
- OXAYXWLBMCQAJC-UHFFFAOYSA-N
- SMILES
- C1(N)=NC=C(OC)C(Cl)=N1
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 그림문자(GHS): |
|
||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Warning | ||||||||||||||||||||||||||||
| 유해·위험 문구: |
|
||||||||||||||||||||||||||||
| 예방조치문구: |
|
4-Chloro-5-methoxypyrimidin-2-amine C화학적 특성, 용도, 생산
용도
4-Chloro-5-methoxypyrimidin-2-amine is a pyrimidine derivative used as a pharmaceutical intermediate for pharmaceutical synthesis and scientific research.4-Chloro-5-methoxypyrimidin-2-amine 준비 용품 및 원자재
원자재
준비 용품
4-Chloro-5-methoxypyrimidin-2-amine 공급 업체
글로벌( 41)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Milestone Chemical Wuxi Co.,Ltd | 18068271528 |
sales@milestonechem.com | China | 9 | 58 |
| Hubei Jusheng Technology Co.,Ltd. | 18871490254 |
linda@hubeijusheng.com | CHINA | 28180 | 58 |
| Alchem Pharmtech,Inc. | 8485655694 |
sales@alchempharmtech.com | United States | 63711 | 58 |
| KARMEL TECHNOLOGY (HK) CO.,LIMITED | +8618795957998 |
karmelhk@126.com | CHINA | 2886 | 58 |
| Shaanxi Dideu Medichem Co. Ltd | +86-029-89586680 +86-18192503167 |
1026@dideu.com | China | 9030 | 58 |
| Jilin Chinese Academy of Sciences-yanshen Technology | +undefined18143011203 |
info@chemextension.com | China | 42057 | 58 |
| Amadis Chemical Company Limited | 571-89925085 |
sales@amadischem.com | China | 131980 | 58 |
| Milestone Chemical Wuxi Co.,Ltd | 18068271528 |
1917265470@qq.com | China | 64 | 58 |
| Amber MolTech LLC | 086-010-62176588 |
amber@jyamber.com | China | 10152 | 56 |
| NovoChemy Ltd. | 021-31261262/ 49 (0)17662837245 |
sales@novochemy.com | Germany | 6331 | 58 |