1-Benzyl-1-methyl-4-oxopiperidinium iodide
|
|
1-Benzyl-1-methyl-4-oxopiperidinium iodide 속성
- InChI
- InChI=1S/C13H18NO.HI/c1-14(9-7-13(15)8-10-14)11-12-5-3-2-4-6-12;/h2-6H,7-11H2,1H3;1H/q+1;/p-1
- InChIKey
- GXCBGFSXHBBEFW-UHFFFAOYSA-M
- SMILES
- C(C1C=CC=CC=1)[N+]1(CCC(=O)CC1)C.[I-]
안전
1-Benzyl-1-methyl-4-oxopiperidinium iodide C화학적 특성, 용도, 생산
Synthesis
Several methods have been employed for the synthesis of 1-Benzyl-1-methyl-4-oxopiperidinium iodide. One commonly used method involves the reaction of 1-benzylpiperidin-4-one with iodomethane.![1-Benzyl-1-methyl-4-oxopiperidinium iodide 1-Benzyl-1-methyl-4-oxopiperidinium iodide](/NewsImg/2023-10-31/6383434577187856596539725.jpg)
1-Benzyl-1-methyl-4-oxopiperidinium iodide 준비 용품 및 원자재
원자재
준비 용품
1-Benzyl-1-methyl-4-oxopiperidinium iodide 공급 업체
글로벌( 25)공급 업체
공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
---|---|---|---|---|---|
Huida Pharmaceutical Technology (Shanghai) Co., Ltd. | +8613601750004 |
lizhi@pharoschem.com | China | 439 | 58 |
ATK CHEMICAL COMPANY LIMITED | +undefined-21-51877795 |
ivan@atkchemical.com | China | 32760 | 60 |
Jinan Carbotang Biotech Co.,Ltd. | +8615866703830 |
figo.gao@foxmail.com | China | 7239 | 58 |
Shanghai Hobor Chemical Co., Ltd | 21-21-61026752 13918007836 |
sales@hoborchem.com | China | 374 | 60 |
ATK CHEMICAL COMPANY LIMITED | 3429815786 13301662590 |
sales@atkchemical.com | China | 10059 | 55 |
Aikon International Limited | 025-66113011 18112977050 |
cb6@aikonchem.com | China | 15495 | 58 |
Jinan Kabotang Biological Technology Co.,Ltd. | 0531-61320525 15866703830 |
495745175@qq.com | China | 6789 | 58 |
Guangdong wengjiang Chemical Reagent Co., Ltd. | 0751-2815688 13927872512 |
3007421951@qq.com | China | 10066 | 58 |
Cangzhou Dimai Technology Co., Ltd | 0317-8586038 13512466848 |
hbdypharm@163.com | China | 196 | 58 |
Henan Weituxi Chemical Technology Co., Ltd. | 0371-63284658 18135795563 |
2885349392@qq.com | China | 9995 | 58 |