36-디클로로-12-벤젠디티올95
|
|
36-디클로로-12-벤젠디티올95 속성
- 녹는점
- 58-60°C (lit.)
- 끓는 점
- 314.9±37.0 °C(Predicted)
- 밀도
- 1.523±0.06 g/cm3(Predicted)
- 산도 계수 (pKa)
- 4.40±0.50(Predicted)
- InChI
- InChI=1S/C6H4Cl2S2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,9-10H
- InChIKey
- AJCUDWCLDWDLNY-UHFFFAOYSA-N
- SMILES
- C1(S)=C(Cl)C=CC(Cl)=C1S
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 그림문자(GHS): |
  
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Danger | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| 유해·위험 문구: |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| 예방조치문구: |
|
36-디클로로-12-벤젠디티올95 C화학적 특성, 용도, 생산
용도
3,6-Dichloro-1,2-benzenedithiol is a stain/dye. Dyes and metabolites.주요 응용
3,6-Dichloro-1,2-benzenedithiol has been used as a ligand in thiolate complexes and a series of homo-chalcogenide and mixed-chalcogenide ligand complexes. For example, Direct reaction between Cu(ClO4)2 and 3,6-dichloro-1,2-benzenedithiol (HSC6H2Cl2SH) in the presence of basic salts leads to a series of bis(dithiolato)cuprate(III) [Cu(SC6H2Cl2S)2]? coordination complexes and coordination polymers. In addition, One-pot reactions between Ni(II), Pd(II), or Pt(II) salts and 3,6-dichloro-1,2-benzenedithiol (HSC6H2Cl2SH) in KOH medium under argon lead to a series of bis-dithiolene coordination polymer[1-2].참고 문헌
[1] Amo-Ochoa, Pilar et al. “Copper dithiolene [Cu(SC6H2Cl2S)2]? units connected to alkaline/copper complexes: from ionic assemblies to discrete molecular entities and coordination polymers?.” CrystEngComm 6 (2018): 957–963.[2] Delgado, Esther et al. “Unprecedented layered coordination polymers of dithiolene group 10 metals: magnetic and electrical properties?.” Dalton Transactions 15 (2016): 6696–6701.
36-디클로로-12-벤젠디티올95 준비 용품 및 원자재
원자재
준비 용품
36-디클로로-12-벤젠디티올95 공급 업체
글로벌( 29)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| R&D Scientific Inc. | +12266000236 |
sales@rdscientific.com | Canada | 1393 | 58 |
| Hangzhou MolCore BioPharmatech Co.,Ltd. | +86-057181025280; +8617767106207 |
sales@molcore.com | China | 49739 | 58 |
| ShenZhen Trendseen Biological Technology Co.,Ltd. | 13417589054 |
trendseenbio@gmail.com | China | 11681 | 58 |
| Shanghai Eyougene biotechnology development co.LTD | +8619822737233 |
sam.chen@eyougene.com | China | 25 | 58 |
| Shanghai Acmec Biochemical Technology Co., Ltd. | +undefined18621343501 |
product@acmec-e.com | China | 33350 | 58 |
| Aladdin Scientific | +1-+1(833)-552-7181 |
sales@aladdinsci.com | United States | 52927 | 58 |
| Suzhou ARTK Medchem Co., Ltd. | +8618168183658 |
sales1@artkmedchem.com | China | 39009 | 58 |
| Syntechem Co.,Ltd | |
info@syntechem.com | China | 12990 | 57 |
| Tianjin heowns Biochemical Technology Co., Ltd. | 400-6387771-6037 18920794737 |
sales@heowns.com | China | 20675 | 60 |
| Sanover (Xiamen) Technology Co., Ltd | 059265188632; 13876246362 |
422165847@qq.com | China | 501 | 58 |