|
|
| | Zinc Triflate Chemical Properties |
| Melting point | ≥300 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to light-gray | | Water Solubility | Soluble in water and acetonitrile. Slightly soluble in methanol. Insoluble in dichloromethane. | | Sensitive | Hygroscopic | | BRN | 4028195 | | Stability: | hygroscopic | | InChI | InChI=1S/2CHF3O3S.Zn/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 | | InChIKey | CITILBVTAYEWKR-UHFFFAOYSA-L | | SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S([O-])(=O)=O.[Zn+2] | | CAS DataBase Reference | 54010-75-2(CAS DataBase Reference) | | EPA Substance Registry System | Methanesulfonic acid, trifluoro-, zinc salt (54010-75-2) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 3-10 | | Hazard Note | Irritant/Hygroscopic | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 |
| | Zinc Triflate Usage And Synthesis |
| Description | Zinc Triflate, also known as Zinc trifluoromethanesulfonate, is an important organic reagent. It acts as a Lewis acid in nucleophilic additions and as a catalyst in aldol reactions. | | Solubility in water | Zinc Triflate is soluble in water and acetonitrile. Slightly soluble in methanol. Insoluble in dichloromethane. |
| | Zinc Triflate Preparation Products And Raw materials |
|