|
|
| | 1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one Basic information |
| Product Name: | 1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one | | Synonyms: | (1S,5R)-1-PHENYL-3-OXA-BICYCLO[3.1.0]HEXAN-2-ONE;2-Oxo-1-phenyl-3-oxabicyclo[3.1.0]-hexane;1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one;(1R,2S)-rel-2-Oxo-1-phenyl-3-oxabicyclo[3.1.0]hexane;2–Oxo-1phenyl-3-oxbicyclo{3.1.0}-hexane2;Milnacipran HCl
PI-1;2-oxo-1phenyl-3-oxbicyclo｛3.1.0｝-hexane;2-oxo-iphenyl-3-oxbicyclo｛3.1.0｝-hexane | | CAS: | 63106-93-4 | | MF: | C11H10O2 | | MW: | 174.2 | | EINECS: | 613-140-8 | | Product Categories: | | | Mol File: | 63106-93-4.mol | ![1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one Structure](CAS/GIF/63106-93-4.gif) |
| | 1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one Chemical Properties |
| Melting point | 49-50 °C | | Boiling point | 119 °C(Press: 0.1 Torr) | | density | 1.300±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform, Methanol | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C11H10O2/c12-10-11(6-9(11)7-13-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2 | | InChIKey | WZGFIZUMKYUMRN-UHFFFAOYSA-N | | SMILES | C12(C3=CC=CC=C3)C(C1)COC2=O |
| | 1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one Usage And Synthesis |
| Uses | Intermediate in the synthesis of Milnacipran (M344600) an antidepressant. A selective norepinephrine and serotonin reuptake inhibitor approved for the management of fibromyalgia. |
| | 1-Phenyl-3-oxabicyclo[3.1.0]hexan-2-one Preparation Products And Raw materials |
|