|
|
| | 2-(Aminomethyl)-5-methylpyrazine Basic information |
| | 2-(Aminomethyl)-5-methylpyrazine Chemical Properties |
| Boiling point | 216.2±35.0 °C(Predicted) | | density | 1.09 | | refractive index | 1.5380-1.5430 | | storage temp. | Refrigerator | | pka | 6.94±0.29(Predicted) | | form | clear liquid | | color | Colorless to Yellow to Green | | Specific Gravity | 1.09 | | InChI | InChI=1S/C6H9N3/c1-5-3-9-6(2-7)4-8-5/h3-4H,2,7H2,1H3 | | InChIKey | MPBCUCGKHDEUDD-UHFFFAOYSA-N | | SMILES | C1(CN)=NC=C(C)N=C1 | | CAS DataBase Reference | 132664-85-8(CAS DataBase Reference) |
| | 2-(Aminomethyl)-5-methylpyrazine Usage And Synthesis |
| Description | 2-(Aminomethyl)-5-methylpyrazine can be used as a pharmaceutical synthesis intermediate, for example, to prepare pyrocatecholamide, which is an antiplatelet drug with a dual inhibitory action. This substance can be prepared from 2,5-dimethylpyrazine as a reaction raw material. | | Synthesis | 2,5-dimethylpyrazine can be used as a reaction raw material to prepare the intermediate 2-chloromethyl-5-methylpyrazine. It can then be further reacted with sodium iodide and potassium phthalimide to prepare N-((5-methylpyrazine-2-yl)methyl)isoindole-1,3-dione. Finally, it can be reacted with hydrazine hydrate to prepare 2-(Aminomethyl)-5-methylpyrazine. |
| | 2-(Aminomethyl)-5-methylpyrazine Preparation Products And Raw materials |
|