| | 4-HO-MiPT Basic information |
| | 4-HO-MiPT Chemical Properties |
| Boiling point | 407.4±35.0 °C(Predicted) | | density | 1.123±0.06 g/cm3(Predicted) | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS(pH7.2) (1:1): 0.5 mg/ml; Ethanol: 0.5 mg/ml | | form | A crystalline solid | | pka | 10.08±0.40(Predicted) | | InChI | InChI=1S/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3 | | InChIKey | RXKGHZCQFXXWFQ-UHFFFAOYSA-N | | SMILES | N1C2=C(C(O)=CC=C2)C(CCN(C)C(C)C)=C1 |
| | 4-HO-MiPT Usage And Synthesis |
| Description | 4-HO-MiPT (miprocin, 4-hydroxy-N-methyl-N-isopropyltryptamine) is a synthetic substituted aromatic compound and a lesser-known psychedelic tryptamine. It is thought to be a serotonergic psychedelic, similar to magic mushrooms, LSD and mescaline. Its molecular structure and pharmacological effects somewhat resemble those of the tryptamine psilocin, which is the primary psychoactive chemical in magic mushrooms. | | Chemical Properties | 4-HO-MiPT was presumably first synthesized by Alexander Shulgin. Its synthesis is described in his book TiHKAL along with reports by people who had ingested the compound. Shulgin's trials and other anecdotal information suggest that 4-HO-MiPT is a synthetic psychedelic similar in activity to psilocin. It is relatively uncommon and has only a short history of human use. | | Uses | 4-hydroxy MiPT is a synthetic tryptamine derivative that is part of the class of drugs known as serotonergic psychedelics, which includes psychoactive mushrooms, LSD, and mescaline. Its effects and molecular structure resemble that of the tryptamine psilocin. This product is intended for forensic and research applications.[Cayman Chemical] |
| | 4-HO-MiPT Preparation Products And Raw materials |
|