1-(Perfluorobut-1-yl)pentane manufacturers
|
| 1-(Perfluorobut-1-yl)pentane Basic information |
Product Name: | 1-(Perfluorobut-1-yl)pentane | Synonyms: | 1,1,1,2,2,3,3,4,4-Nonafluorononane97%;1-(Perfluorobut-1-yl)pentane;1,1,1,2,2,3,3,4,4-Nonafluorononane 97%;1,1,1,2,2,3,3,4,4-Nonafluorononane;1-(Perfluorobutyl)pentane;Nonane, 1,1,1,2,2,3,3,4,4-nonafluoro-;1-(Perfluorobutyl)pentane (Fandachem);FANDACHEM 1-(Perfluorobutyl)pentane 97% | CAS: | 1190430-21-7 | MF: | C9H11F9 | MW: | 290.17 | EINECS: | | Product Categories: | | Mol File: | 1190430-21-7.mol |  |
| 1-(Perfluorobut-1-yl)pentane Chemical Properties |
Boiling point | 152.1±8.0 °C(Predicted) | density | 1.282±0.06 g/cm3(Predicted) | form | liquid | color | Clear | InChI | InChI=1S/C9H11F9/c1-2-3-4-5-6(10,11)7(12,13)8(14,15)9(16,17)18/h2-5H2,1H3 | InChIKey | GYDMBTYTWYNRGO-UHFFFAOYSA-N | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC | EPA Substance Registry System | 1,1,1,2,2,3,3,4,4-Nonafluorononane (1190430-21-7) |
| 1-(Perfluorobut-1-yl)pentane Usage And Synthesis |
| 1-(Perfluorobut-1-yl)pentane Preparation Products And Raw materials |
|