|
| 3,5-dichloro-4-formylbenzoic acid Basic information |
Product Name: | 3,5-dichloro-4-formylbenzoic acid | Synonyms: | 3,5-dichloro-4-formylbenzoic acid;Benzoic acid, 3,5-dichloro-4-formyl-;Lusutrombopag Impurity 8;Ethane,1-bromo-2-(5-methoxyethoxy)-;Lusutrombopag Impurity 4 | CAS: | 153203-80-6 | MF: | C8H4Cl2O3 | MW: | 219.02 | EINECS: | | Product Categories: | | Mol File: | 153203-80-6.mol | ![3,5-dichloro-4-formylbenzoic acid Structure](CAS/20180629/GIF/153203-80-6.gif) |
| 3,5-dichloro-4-formylbenzoic acid Chemical Properties |
Boiling point | 366.7±42.0 °C(Predicted) | density | 1.592±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | DMSO (Slightly), Ethyl Acetate (Slightly) | form | Solid | pka | 3.04±0.10(Predicted) | color | White to Pale Beige | InChI | InChI=1S/C8H4Cl2O3/c9-6-1-4(8(12)13)2-7(10)5(6)3-11/h1-3H,(H,12,13) | InChIKey | KNZHVHRJCNWQKI-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=CC(Cl)=C(C=O)C(Cl)=C1 |
| 3,5-dichloro-4-formylbenzoic acid Usage And Synthesis |
| 3,5-dichloro-4-formylbenzoic acid Preparation Products And Raw materials |
|