| Company Name: |
Shanghai AmasPharm Co., Ltd.
|
| Tel: |
021-54540637 18621091017 |
| Email: |
sales@amaspharm.com |
| Products Intro: |
Product Name:2-Bromo-1-(2-fluoro-4-hydroxy-phenyl)-ethanone
CAS:220131-30-6
Purity:97% Package:100g;500g
|
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18086626237 18086626237 |
| Email: |
sales@debyesci.com |
| Products Intro: |
Product Name:2-Bromo-1-(2-fluoro-4-hydroxy-phenyl)-ethanone
CAS:220131-30-6
Purity:95+% HPLC Package:1g;5g;10g;25g;100g;500g;1kg;
|
| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:2-Bromo-1-(2-fluoro-4-hydroxy-phenyl)-ethanone
CAS:220131-30-6
Purity:>97% Package:1g;5g Remarks:B1-4469
|
|
| | Ethanone, 2-bromo-1-(2-fluoro-4-hydroxyphenyl)- Basic information |
| | Ethanone, 2-bromo-1-(2-fluoro-4-hydroxyphenyl)- Chemical Properties |
| Boiling point | 343.5±27.0 °C(Predicted) | | density | 1.703±0.06 g/cm3(Predicted) | | pka | 6.73±0.20(Predicted) | | InChI | InChI=1S/C8H6BrFO2/c9-4-8(12)6-2-1-5(11)3-7(6)10/h1-3,11H,4H2 | | InChIKey | WLXXRLYAYQQESZ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C=C1F)CBr |
| | Ethanone, 2-bromo-1-(2-fluoro-4-hydroxyphenyl)- Usage And Synthesis |
| | Ethanone, 2-bromo-1-(2-fluoro-4-hydroxyphenyl)- Preparation Products And Raw materials |
|