|
|
| | Bis-Aminopropyl Diglycol Dimaleate Basic information |
| Product Name: | Bis-Aminopropyl Diglycol Dimaleate | | Synonyms: | 3,3'-[Oxybis(2,1-ethanediyloxy)]bis-1-propanamine (2Z)-2-butenedioate (1:2);3-{2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy}propan-1-aminium bis((2Z)-3-carboxyprop-2-enoate);BIS-AMINOPROPYL DIGLYCOL DIMALEATE;3,3'-[Oxybis(2,1-ethanediyloxy)]bis-1-propanamine (2Z)-2-butenedioate | | CAS: | 1629579-82-3 | | MF: | C14H28N2O7 | | MW: | 336.39 | | EINECS: | 818-033-1 | | Product Categories: | | | Mol File: | 1629579-82-3.mol |  |
| | Bis-Aminopropyl Diglycol Dimaleate Chemical Properties |
| density | 1.18 at 20°C | | density | 1.18 at 20℃ | | vapor pressure | 0-0Pa at 20-25℃ | | vapor pressure | 0-0Pa at 20-25°C | | InChI | InChI=1S/C10H24N2O3.C4H4O4/c11-3-1-5-13-7-9-15-10-8-14-6-2-4-12;5-3(6)1-2-4(7)8/h1-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1- | | InChIKey | AHCLXVDSJKEGCO-BTJKTKAUSA-N | | SMILES | C(/C(=O)O)=C/C(=O)O.O(CCOCCCN)CCOCCCN | | LogP | -2.8--2.4 at 20℃ and pH4.3 | | Surface tension | 72.8mN/m at 1g/L and 20℃ |
| | Bis-Aminopropyl Diglycol Dimaleate Usage And Synthesis |
| Description | Bis-aminopropyl diglycol dimaleate is the salt of maleic acid (q.v.), and the diamine formed between diethylene glycol (q.v.) and 1-aminopropane. It is a single molecule that works in a unique way to quickly and effectively repair broken bonds and restore healthy hair. |
| | Bis-Aminopropyl Diglycol Dimaleate Preparation Products And Raw materials |
|