- 3,4-diacetoxystyrene
-
- $0.00 / 10g
-
2024-10-02
- CAS:57142-64-0
- Min. Order: 10g
- Purity: 97%+
- Supply Ability: 100000kgs per Month
- 3,4-diacetoxystyrene
-
- $1.00 / 1kg
-
2019-07-06
- CAS:57142-64-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | 3,4-diacetoxystyrene Basic information |
| Product Name: | 3,4-diacetoxystyrene | | Synonyms: | 3,4-diacetoxystyrene;1,2-Benzenediol, 4-ethenyl-, 1,2-diacetate;Acetic acid,4-ethenylbenzene-1,2-diol;4-Vinyl-1,2-phenylene diacetate | | CAS: | 57142-64-0 | | MF: | C12H12O4 | | MW: | 220.22 | | EINECS: | | | Product Categories: | | | Mol File: | 57142-64-0.mol |  |
| | 3,4-diacetoxystyrene Chemical Properties |
| InChI | InChI=1S/C12H12O4/c1-4-10-5-6-11(15-8(2)13)12(7-10)16-9(3)14/h4-7H,1H2,2-3H3 | | InChIKey | BGDWDFVUSUCDHI-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC=C(C=C)C=C1OC(=O)C |
| | 3,4-diacetoxystyrene Usage And Synthesis |
| Uses | 3,4-diacetoxystyrene can serve as a fluorescent or linking group and participate in the synthesis of various anti-tumor drugs. For example, it can promote tumour cell death by binding to DNA or serve as a fluorescent probe for tumour cell imaging. 3,4-diacetoxystyrene plays an essential role in the synthesis of anti-inflammatory drugs. It can serve as a structural template for osteoporosis drugs, enhancing their anti-inflammatory activity by modifying their substituents or introducing double bonds. |
| | 3,4-diacetoxystyrene Preparation Products And Raw materials |
|