2,4-DIMETHYL-1,3-PENTADIENE manufacturers
|
| 2,4-DIMETHYL-1,3-PENTADIENE Basic information |
Product Name: | 2,4-DIMETHYL-1,3-PENTADIENE | Synonyms: | 2,4-DIMETHYL-1,3-PENTADIENE;1,1,3-Trimethylbutadiene;1,3-Pentadiene, 2,4-dimethyl-;1,3-pentadiene,2,4-dimethyl-;2,4-dimethyl-penta-1,3-diene;2,4-dimethylpenta-2,4-diene;2,4-DIMETHYL-1,3-PENTADIENE, 98+%;2,4-DIMETHYL-1,3-PENTADIENE 98% | CAS: | 1000-86-8 | MF: | C7H12 | MW: | 96.17 | EINECS: | 213-677-4 | Product Categories: | Acyclic;Alkenes;Organic Building Blocks;Building Blocks;Chemical Synthesis;Organic Building Blocks | Mol File: | 1000-86-8.mol | ![2,4-DIMETHYL-1,3-PENTADIENE Structure](CAS/GIF/1000-86-8.gif) |
| 2,4-DIMETHYL-1,3-PENTADIENE Chemical Properties |
Melting point | -114℃ | Boiling point | 94 °C (lit.) | density | 0.744 g/mL at 25 °C (lit.) | vapor pressure | 67 mm Hg ( 37.7 °C) | refractive index | n20/D 1.441(lit.) | Fp | 50 °F | storage temp. | Flammables area | form | Liquid | color | Clear colorless to light yellow | InChI | InChI=1S/C7H12/c1-6(2)5-7(3)4/h5H,1H2,2-4H3 | InChIKey | CMSUNVGIWAFNBG-UHFFFAOYSA-N | SMILES | C=C(C)/C=C(\C)/C | CAS DataBase Reference | 1000-86-8 |
Hazard Codes | F,Xi | Risk Statements | 11-36/37/38 | Safety Statements | 16-26-36/37/39 | RIDADR | UN 3295 3/PG 2 | WGK Germany | 3 | HazardClass | 3.1 | PackingGroup | II | HS Code | 29012900 |
| 2,4-DIMETHYL-1,3-PENTADIENE Usage And Synthesis |
Chemical Properties | CLEAR COLORLESS TO LIGHT YELLOW LIQUID | Uses | 2,4-Dimethyl-1,3-pentadiene has been used to study the structure of its various conformational isomers and their vibrational spectra. |
| 2,4-DIMETHYL-1,3-PENTADIENE Preparation Products And Raw materials |
Raw materials | 3,3,5,5-tetramethyllimonene-->2-Pentene, 4-chloro-2,4-dimethyl--->3-bromo-1,1,2,2-tetramethylcyclopropane-->3-Penten-2-ol, 2,4-dimethyl--->TETRAMETHYLALLENE-->2,4-DIMETHYL-2-PENTENE-->2,4-Dimethyl-3-pentanone-->Trimethylphosphine-->Methanol-->Trifluoromethanesulfonic acid-->Triethylamine-->Mesityl oxide |
|