|
|
| | Pyridinium p-Toluenesulfonate Basic information |
| | Pyridinium p-Toluenesulfonate Chemical Properties |
| Melting point | 117-120 °C | | density | 1.2829 (rough estimate) | | vapor pressure | 40Pa at 20℃ | | refractive index | 1.6000 (estimate) | | storage temp. | Store below +30°C. | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Crystalline Powder or Crystals | | color | White to light beige | | Water Solubility | decomposes | | Sensitive | Moisture Sensitive | | BRN | 3764305 | | InChI | InChI=1S/C7H8O3S.C5H5N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1/h2-5H,1H3,(H,8,9,10);1-5H | | InChIKey | ZDYVRSLAEXCVBX-UHFFFAOYSA-N | | SMILES | C1(S(=O)(=O)O)C=CC(C)=CC=1.C1=CC=NC=C1 | | CAS DataBase Reference | 24057-28-1(CAS DataBase Reference) | | EPA Substance Registry System | Pyridinium p-toluenesulfonate (24057-28-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 9-21 | | TSCA | Yes | | HS Code | 29333100 |
| | Pyridinium p-Toluenesulfonate Usage And Synthesis |
| Chemical Properties | white to light beige crystalline powder or | | Uses | Pyridinium p-Toluenesulfate is used in the synthesis of a subdomain of the cytochrome P450 BM3 enzyme, for use in screening systems for drug candidates. | | Uses | As a co-catalyst with L-proline improved both yield and enantioselectivity of an asymmetric aldol condensation between dioxanones and aldehydes.1 | | Uses | Pyridinium p-Toluenesulfonate is used in the synthesis of a subdomain of the cytochrome P450 BM3 enzyme, for use in screening systems for drug candidates. | | Flammability and Explosibility | Not classified |
| | Pyridinium p-Toluenesulfonate Preparation Products And Raw materials |
|