| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:N-(2,3-dihydro-1H-inden-1-yl)-N-(prop-2-yn-1-yl)nitrous amide
Purity:95% HPLC Package:10MG ;25MG;50MG;100MG Remarks:DCTI-B-130
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@qq.com |
| Products Intro: |
Product Name:N-Despropargyl N-(2-Chloroallyl) Rasagiline
CAS:1175018-73-1
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai CR Corporation Limited
|
| Tel: |
4006653949 |
| Email: |
fred.wen@crcorporation.cn |
| Products Intro: |
Product Name:N-Despropargyl N-(2-Chloroallyl) Rasagiline
CAS:1175018-73-1
Purity:95+
|
|
| | 1175018-73-1 Basic information |
| Product Name: | 1175018-73-1 | | Synonyms: | 1H-Inden-1-amine, N-(2-chloro-2-propen-1-yl)-2,3-dihydro-, (1R)-;N-2-propene-1yl-2-chloro-R-aminoindaneQ: What is
N-2-propene-1yl-2-chloro-R-aminoindane Q: What is the CAS Number of
N-2-propene-1yl-2-chloro-R-aminoindane Q: What is the storage condition of
N-2-propene-1yl-2-chloro-R-aminoindane Q: What are the applications of
N-2-propene-1yl-2-chloro-R-aminoindane;N-2-propene-1-yl-2-chloro-(R)-aminoindan;N-2-Propene-1yl-2-chloro-R-aminoindane | | CAS: | 1175018-73-1 | | MF: | C12H14ClN | | MW: | 207.7 | | EINECS: | | | Product Categories: | | | Mol File: | 1175018-73-1.mol |  |
| | 1175018-73-1 Chemical Properties |
| Boiling point | 318.3±37.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Oil | | pka | 4.32±0.20(Predicted) | | color | Pale Yellow |
| | 1175018-73-1 Usage And Synthesis |
| Uses | N-Despropargyl N-(2-Chloroallyl) Rasagiline is used in the preparation of Rasagiline mesylate and chloro derivative impurities. Also, a derivative compound of Rasagiline mesylate (R126000) that functions an irreversible MAO-B inhibitor and also as an antiparkinsonian agent. |
| | 1175018-73-1 Preparation Products And Raw materials |
|