|
|
| | 7-methoxy-3,4-dihydro-1-naphthalenylacetonitrile Basic information |
| Product Name: | 7-methoxy-3,4-dihydro-1-naphthalenylacetonitrile | | Synonyms: | 7-METHOXY-3,4-DIHYDRO-1-NAPHTHALENYL-ACETONITRILE;3,4-Dihydro-7-Methoxy-1-naphthaleneacetonitrile;(7-Methoxy-3,4-dihydro-1-naphthyl)acetonitrile;7-Methoxy-3,4dihydro-1-naphthalenylaccetonitrile;1-Naphthaleneacetonitrile, 3,4-dihydro-7-methoxy-;7-Methoxy-3,4-Dihydro-1-Naphthalenyl-acetonitrile 7-METHOXY-3,4-DIHYDRO-1-NAPHTHALENYL-ACETONITRILE;2-(7-Methoxy-3,4-dihydronaphthalen-1-yl)acetonitrile;Agomelatine Impurity N10 | | CAS: | 861960-34-1 | | MF: | C13H13NO | | MW: | 199.25 | | EINECS: | 617-813-7 | | Product Categories: | Aromatics Compounds;Aromatics;Intermediate of Agomelatine | | Mol File: | Mol File |  |
| | 7-methoxy-3,4-dihydro-1-naphthalenylacetonitrile Chemical Properties |
| Melting point | 41-43°C | | Boiling point | 349.6±42.0 °C(Predicted) | | density | 1.091±0.06 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C13H13NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h4-6,9H,2-3,7H2,1H3 | | InChIKey | MGJHVZKRAOYORH-UHFFFAOYSA-N | | SMILES | C1(CC#N)C2=C(C=CC(OC)=C2)CCC=1 | | LogP | 2.42 at 30℃ and pH6.6 | | CAS DataBase Reference | 861960-34-1 |
| | 7-methoxy-3,4-dihydro-1-naphthalenylacetonitrile Usage And Synthesis |
| Description | 7-methoxy-3,4-dihydro-1-naphthalenylacetonitrile is an impurity standard compound and an intermediate component of agomelatine. It is mainly used in the field of analytical research or organic synthesis. | | Chemical Properties | White Solid | | Uses | 7-Methoxy-3,4-dihydro-1-naphthalenyl-acetonitrile (cas# 861960-34-1) is a compound useful in organic synthesis. |
| | 7-methoxy-3,4-dihydro-1-naphthalenylacetonitrile Preparation Products And Raw materials |
|