DICAPTHON manufacturers
- DICAPTHON
-
- $15.00 / 1KG
-
2021-08-12
- CAS:2463-84-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | DICAPTHON Basic information |
| Product Name: | DICAPTHON | | Synonyms: | dicapthon (ansi,esa);phosphorothioicacid,o-(2-chloro-4-nitrophenyl)o,o-dimethylester;phosphorothioicacido-(2-chloro-4-nitrophenyl)o,o-dimethylester;p-Nitro-o-chlorophenyl dimethyl thionophosphate;p-nitro-o-chlorophenyldimethylthionophosphate;Thiophosphate de O,O-dimethyle et de O-4-chloro-3-nitrophenyle;thiophosphatedeo,o-dimethyleetdeo-4-chloro-3-nitrophenyle;thiophosphatedeo,o-dimethyleetdeo-4-chloro-3-nitrophenyle(french) | | CAS: | 2463-84-5 | | MF: | C8H9ClNO5PS | | MW: | 297.65 | | EINECS: | | | Product Categories: | Alpha sort;D;DAlphabetic;DIA - DICPesticides;Insecticides;Organophorous;Pesticides&Metabolites | | Mol File: | 2463-84-5.mol |  |
| | DICAPTHON Chemical Properties |
| Melting point | 53℃ | | Boiling point | 355.8±52.0 °C(Predicted) | | density | 1.499±0.06 g/cm3(Predicted) | | form | Solid | | Water Solubility | 7.8mg/L(room temperature) | | CAS DataBase Reference | 2463-84-5 | | EPA Substance Registry System | Dicapthon (2463-84-5) |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 36 | | RIDADR | 2783 | | RTECS | TE7875000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29201900 | | Hazardous Substances Data | 2463-84-5(Hazardous Substances Data) | | Toxicity | LD50 in male, female rats (mg/kg): 400, 330 orally; 790, 1250 dermally (Gaines) |
| | DICAPTHON Usage And Synthesis |
| Uses | Insecticide. | | Uses | Dicapthon is an organophosphorus pesticide. |
| | DICAPTHON Preparation Products And Raw materials |
|