|
|
| | 3-(Dimethylamino)benzoic acid Basic information |
| | 3-(Dimethylamino)benzoic acid Chemical Properties |
| Melting point | 148-150 °C(lit.) | | Boiling point | 293.03°C (rough estimate) | | density | 1.1603 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Store below +30°C. | | solubility | Practically insoluble[in water] | | solubility | methanol: 50mg/mL, clear to very slightly hazy, yellow to brown | | form | Crystalline Powder | | pka | 3.36±0.10(Predicted) | | color | Light yellow to yellow-beige | | Water Solubility | Soluble in methanol (50 mg/ml). Insoluble in water. | | BRN | 2208586 | | InChI | InChI=1S/C9H11NO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H,11,12) | | InChIKey | NEGFNJRAUMCZMY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(N(C)C)=C1 | | CAS DataBase Reference | 99-64-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 3-(dimethylamino)- (99-64-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29224995 |
| | 3-(Dimethylamino)benzoic acid Usage And Synthesis |
| Chemical Properties | Light yellow to yellow-beige crystalline powder | | Uses | 3-(Dimethylamino)benzoic acid has been used to analyse glucose content from the extraction of starch and soluble sugars. | | Uses | 3-Dimethylaminobenzoic acid is used as a benzoic acid derivative. | | Biochem/physiol Actions | 3-dimethylaminobenzoic?acid?(DMAB)?can be used to quantity the activity of peroxidase and manganese peroxidase. |
| | 3-(Dimethylamino)benzoic acid Preparation Products And Raw materials |
|