|
| 2-Methoxypyrimidine-5-boronic acid Basic information |
| 2-Methoxypyrimidine-5-boronic acid Chemical Properties |
Melting point | 161°C(lit.) | Boiling point | 378.3±52.0 °C(Predicted) | density | 1.33±0.1 g/cm3(Predicted) | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | solubility | soluble in Methanol | form | powder to crystal | pka | 5.59±0.11(Predicted) | color | White to Light yellow | InChI | InChI=1S/C5H7BN2O3/c1-11-5-7-2-4(3-8-5)6(9)10/h2-3,9-10H,1H3 | InChIKey | YPWAJLGHACDYQS-UHFFFAOYSA-N | SMILES | B(C1=CN=C(OC)N=C1)(O)O | CAS DataBase Reference | 628692-15-9(CAS DataBase Reference) |
| 2-Methoxypyrimidine-5-boronic acid Usage And Synthesis |
Chemical Properties | Off-white to light yellow solid | Production Methods | 5-Bromo-2-methoxypyrimidine could synthesize 2-Methoxypyrimidine-5-boronic acid as the start material. |
| 2-Methoxypyrimidine-5-boronic acid Preparation Products And Raw materials |
|