|
| 1,1-Diisopropoxytrimethylamine Basic information |
Product Name: | 1,1-Diisopropoxytrimethylamine | Synonyms: | 1,1-DIISOPROPOXYTRIMETHYLAMINE;N,N-DIMETHYLFORMAMIDE DIISOPROPYL ACETAL;N,N-DIMETHYLFORMAMIDE DI-N-PROPYL ACETAL;N,N,N-trimethyl-1,1-bis(1-methylethoxy)amine;N,N-Dimethylformamide dimethylacetate;1,1-diisopropoxy-n,n-dimethylmethylamine;Dimethyl(diisopropoxymethyl)amine;N,N-Dimethyl-α,α-bis(isopropyloxy)methanamine | CAS: | 18503-89-4 | MF: | C9H21NO2 | MW: | 175.27 | EINECS: | 242-386-5 | Product Categories: | | Mol File: | 18503-89-4.mol | ![1,1-Diisopropoxytrimethylamine Structure](CAS/GIF/18503-89-4.gif) |
| 1,1-Diisopropoxytrimethylamine Chemical Properties |
Boiling point | 79-80 °C60 mm Hg(lit.) | density | 0.838 g/mL at 25 °C(lit.) | refractive index | n20/D 1.409(lit.) | Fp | 74 °F | pka | 5.47±0.50(Predicted) | BRN | 1901978 | InChI | InChI=1S/C9H21NO2/c1-7(2)11-9(10(5)6)12-8(3)4/h7-9H,1-6H3 | InChIKey | XOZZATXWQMOVHL-UHFFFAOYSA-N | SMILES | C(OC(C)C)(OC(C)C)N(C)C | CAS DataBase Reference | 18503-89-4(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38-10 | Safety Statements | 26-36 | RIDADR | UN 1993 3/PG 3 | WGK Germany | 3 | HazardClass | 3.2 | PackingGroup | III | HS Code | 2922190090 |
| 1,1-Diisopropoxytrimethylamine Usage And Synthesis |
Uses | N,N-Dimethylformamide diisopropyl acetal was used in the quantification of cocaine and its metabolite, benzoyl ecgonine from urine matrix. |
| 1,1-Diisopropoxytrimethylamine Preparation Products And Raw materials |
|