- 11α-Hydroxy Mexrenone
-
- $20.00/ kg
-
2024-05-11
- CAS:192704-56-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 20
|
| | 11-a-Hydroxy canrenone methyl ester Basic information |
| Product Name: | 11-a-Hydroxy canrenone methyl ester | | Synonyms: | 11-a-Hydroxy canrenone methyl ester;11-ALPHA-HYDROXY-7-ALPHA-(METHOXYCARBONYL)-3-OXOPREGN-4-ENE-21,17-ALPHA-CARBOLACTONE;(7α,11α,17α)-11,17-Dihydroxy-3-oxopregn-4-ene-7,21-dicarboxylic Acid γ-Lactone Methyl Ester;11α,17β-Dihydroxypregn-4-en-3-one 7α,21-dicarboxylic Acid γ-Lactone Methyl Ester;11α-Hydroxy Mexrenone;11α-HydroxyMexrenone;11-Alpha-Hydroxy canrenone methyl ester;Eplerenone intermediate A2 | | CAS: | 192704-56-6 | | MF: | C24H32O6 | | MW: | 416.51 | | EINECS: | 206-141-6 | | Product Categories: | (intermediate of eplerenone) | | Mol File: | 192704-56-6.mol |  |
| | 11-a-Hydroxy canrenone methyl ester Chemical Properties |
| Boiling point | 604.5±55.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.40±0.70(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | ZYDNRZOTRVTMRC-ROUXWHDHNA-N | | SMILES | C1[C@]2(C)[C@@]3([H])[C@H](O)C[C@]4(C)[C@]5(CCC(=O)O5)CC[C@@]4([H])[C@]3([H])[C@H](C(OC)=O)CC2=CC(=O)C1 |&1:1,3,5,8,10,18,20,22,r| | | CAS DataBase Reference | 192704-56-6 |
| | 11-a-Hydroxy canrenone methyl ester Usage And Synthesis |
| Uses | 11a-Hydroxy Mexrenone is an intermediate used in the chemobiological synthesis of Eplerenone (E588775), a cardiovascular drug. |
| | 11-a-Hydroxy canrenone methyl ester Preparation Products And Raw materials |
|