|
| 2,6-DIMETHYL-4-NITROSOPHENOL Basic information |
Product Name: | 2,6-DIMETHYL-4-NITROSOPHENOL | Synonyms: | MCP;4-Methyl-6-cyclohexyl-2-pirone;6-CYCLOHEXYL-4-METHYL PYRAN-2-ONE;6-CYCLOHEXYL-4-METHYL-2-PYRONE;2,6-Dimethyl-4-nitrosophenol;Ciclopirox Related Compound B (25 mg) (6-Cyclohexyl-4-methyl-2-pyrone);Ciclopirox Related CoMpound B, USP;6-Cyclohexyl-4-Methyl-2H-pyran-2-one | CAS: | 14818-35-0 | MF: | C12H16O2 | MW: | 192.25 | EINECS: | 236-382-2 | Product Categories: | Heterocycles;Intermediates | Mol File: | 14818-35-0.mol | |
| 2,6-DIMETHYL-4-NITROSOPHENOL Chemical Properties |
Melting point | >47°C (dec.) | Boiling point | 332.2±11.0 °C(Predicted) | density | 1.088±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | form | Solid | color | White to Off-White | Stability: | Light Sensitive | InChI | InChI=1S/C12H16O2/c1-9-7-11(14-12(13)8-9)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3 | InChIKey | GPKRKAFTZYODFF-UHFFFAOYSA-N | SMILES | C1(=O)OC(C2CCCCC2)=CC(C)=C1 |
WGK Germany | 3 | HS Code | 2932206000 |
| 2,6-DIMETHYL-4-NITROSOPHENOL Usage And Synthesis |
Uses | 6-Cyclohexyl-4-methyl-2H-pyran-2-one (Ciclopirox EP Impurity B) is a a dialkylated pyranone derivative. | Uses | 6-Cyclohexyl-4-methyl-2H-pyran-2-one is a a dialkylated pyranone derivative. |
| 2,6-DIMETHYL-4-NITROSOPHENOL Preparation Products And Raw materials |
|