|
|
| | 4'-Chloro-2-phenylacetophenone Basic information |
| | 4'-Chloro-2-phenylacetophenone Chemical Properties |
| Melting point | 103-107 °C(lit.) | | Boiling point | 187°C/8mmHg(lit.) | | density | 1.191±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Orange to Green | | BRN | 976443 | | InChI | InChI=1S/C14H11ClO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 | | InChIKey | DXVALSKCLLBZEB-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(Cl)C=C1)CC1=CC=CC=C1 | | CAS DataBase Reference | 1889-71-0(CAS DataBase Reference) |
| Hazard Codes | Xi,N | | Risk Statements | 41-43-51/53 | | Safety Statements | 26-39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HazardClass | 9 | | PackingGroup | Ⅲ | | HS Code | 2914790090 |
| | 4'-Chloro-2-phenylacetophenone Usage And Synthesis |
| Uses | 4'-Chloro-2-phenylacetophenone is used in organic synthesis and experimental research.
| | Synthesis Reference(s) | Journal of the American Chemical Society, 89, p. 7009, 1967 DOI: 10.1021/ja01002a033
The Journal of Organic Chemistry, 48, p. 4407, 1983 DOI: 10.1021/jo00171a056 |
| | 4'-Chloro-2-phenylacetophenone Preparation Products And Raw materials |
|